C22H37NO7 — CID 163985525
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(2,2-dimethoxyethylamino)acetate (PubChem CID 163985525) has the molecular formula C22H37NO7 and a molecular weight of 427.54 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(2,2-dimethoxyethylamino)acetate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(2,2-dimethoxyethylamino)acetate |
|---|---|
| PubChem CID | 163985525 |
| Molecular Formula | C22H37NO7 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(2,2-dimethoxyethylamino)acetate |
| SMILES | COC(CNCC(=O)O[C@@H]1CC[C@]2(CO2)[C@@H]([C@@]2(C)O[C@@H]2CC=C(C)C)[C@@H]1OC)OC |
| InChI | InChI=1S/C22H37NO7/c1-14(2)7-8-16-21(3,30-16)20-19(27-6)15(9-10-22(20)13-28-22)29-17(24)11-23-12-18(25-4)26-5/h7,15-16,18-20,23H,8-13H2,1-6H3/t15-,16-,19-,20-,21+,22+/m1/s1 |
| InChIKey | TVYRRIXWNKPONI-PWNYLBOHSA-N |
| XLogP | 1.81 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|