C23H39NO6 — CID 23547012
[5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-[(2-methoxy-2-methylpropyl)amino]acetate (PubChem CID 23547012) has the molecular formula C23H39NO6 and a molecular weight of 425.57 g/mol. Its IUPAC name is [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-[(2-methoxy-2-methylpropyl)amino]acetate.
| Compound Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-[(2-methoxy-2-methylpropyl)amino]acetate |
|---|---|
| PubChem CID | 23547012 |
| Molecular Formula | C23H39NO6 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-[(2-methoxy-2-methylpropyl)amino]acetate |
| SMILES | COC1C(OC(=O)CNCC(C)(C)OC)CCC2(CO2)C1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C23H39NO6/c1-15(2)8-9-17-22(5,30-17)20-19(26-6)16(10-11-23(20)14-28-23)29-18(25)12-24-13-21(3,4)27-7/h8,16-17,19-20,24H,9-14H2,1-7H3 |
| InChIKey | YQUMYMKBYHIZMC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|