C48H54N4O — CID 123791538
8-[7-butyl-2,4-bis(2-methylpropyl)dibenzofuran-3-yl]-2,4-diethyl-18-phenyl-11,13,16,18-tetrazapentacyclo[9.7.0.02,4.05,10.012,17]octadeca-5(10),6,8,12,14,16-hexaene (PubChem CID 123791538) has the molecular formula C48H54N4O and a molecular weight of 702.99 g/mol. Its IUPAC name is 8-[7-butyl-2,4-bis(2-methylpropyl)dibenzofuran-3-yl]-2,4-diethyl-18-phenyl-11,13,16,18-tetrazapentacyclo[9.7.0.02,4.05,10.012,17]octadeca-5(10),6,8,12,14,16-hexaene.
| Compound Name | 8-[7-butyl-2,4-bis(2-methylpropyl)dibenzofuran-3-yl]-2,4-diethyl-18-phenyl-11,13,16,18-tetrazapentacyclo[9.7.0.02,4.05,10.012,17]octadeca-5(10),6,8,12,14,16-hexaene |
|---|---|
| PubChem CID | 123791538 |
| Molecular Formula | C48H54N4O |
| Molecular Weight | 702.99 g/mol |
| Exact Mass | 702.43 |
| IUPAC Name | 8-[7-butyl-2,4-bis(2-methylpropyl)dibenzofuran-3-yl]-2,4-diethyl-18-phenyl-11,13,16,18-tetrazapentacyclo[9.7.0.02,4.05,10.012,17]octadeca-5(10),6,8,12,14,16-hexaene |
| SMILES | CCCCc1ccc2c(c1)oc1c(CC(C)C)c(-c3ccc4c(c3)N3c5nccnc5N(c5ccccc5)C3C3(CC)CC43CC)c(CC(C)C)cc12 |
| InChI | InChI=1S/C48H54N4O/c1-8-11-15-32-18-20-36-37-27-34(24-30(4)5)42(38(25-31(6)7)43(37)53-41(36)26-32)33-19-21-39-40(28-33)52-45-44(49-22-23-50-45)51(35-16-13-12-14-17-35)46(52)48(10-3)29-47(39,48)9-2/h12-14,16-23,26-28,30-31,46H,8-11,15,24-25,29H2,1-7H3 |
| InChIKey | YOHKLUBVUWIIGY-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.99 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |