C19H16N4O2S — CID 123793411
5,7-bis(5-methoxy-3-pyridinyl)-1,3-benzothiazol-2-amine (PubChem CID 123793411) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is 5,7-bis(5-methoxy-3-pyridinyl)-1,3-benzothiazol-2-amine.
| Compound Name | 5,7-bis(5-methoxy-3-pyridinyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 123793411 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 5,7-bis(5-methoxy-3-pyridinyl)-1,3-benzothiazol-2-amine |
| SMILES | COc1cncc(-c2cc(-c3cncc(OC)c3)c3sc(N)nc3c2)c1 |
| InChI | InChI=1S/C19H16N4O2S/c1-24-14-3-12(7-21-9-14)11-5-16(13-4-15(25-2)10-22-8-13)18-17(6-11)23-19(20)26-18/h3-10H,1-2H3,(H2,20,23) |
| InChIKey | GZFJQHPCLSWLHJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |