C36H23N3O2 — CID 123793982
11-(3,5-diphenylphenyl)-20-hydroxy-1,4,7-triazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaen-2-one (PubChem CID 123793982) has the molecular formula C36H23N3O2 and a molecular weight of 529.60 g/mol. Its IUPAC name is 11-(3,5-diphenylphenyl)-20-hydroxy-1,4,7-triazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaen-2-one.
| Compound Name | 11-(3,5-diphenylphenyl)-20-hydroxy-1,4,7-triazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaen-2-one |
|---|---|
| PubChem CID | 123793982 |
| Molecular Formula | C36H23N3O2 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 11-(3,5-diphenylphenyl)-20-hydroxy-1,4,7-triazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaen-2-one |
| SMILES | O=c1c2nccnc2c2cc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)cc3c2n1C(O)c1ccccc1-3 |
| InChI | InChI=1S/C36H23N3O2/c40-35-29-14-8-7-13-28(29)30-20-27(21-31-32-33(38-16-15-37-32)36(41)39(35)34(30)31)26-18-24(22-9-3-1-4-10-22)17-25(19-26)23-11-5-2-6-12-23/h1-21,35,40H |
| InChIKey | AXPNEZSHCFHWMZ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|