C5H8N2O — CID 123794721
4-imino-3,5-dihydro-2H-pyridin-2-ol (PubChem CID 123794721) has the molecular formula C5H8N2O and a molecular weight of 112.13 g/mol. Its IUPAC name is 4-imino-3,5-dihydro-2H-pyridin-2-ol.
| Compound Name | 4-imino-3,5-dihydro-2H-pyridin-2-ol |
|---|---|
| PubChem CID | 123794721 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 4-imino-3,5-dihydro-2H-pyridin-2-ol |
| SMILES | [H]/N=C1\CC=NC(O)C1 |
| InChI | InChI=1S/C5H8N2O/c6-4-1-2-7-5(8)3-4/h2,5-6,8H,1,3H2/b6-4+ |
| InChIKey | DYGXHTYCZRPNJD-GQCTYLIASA-N |
| XLogP | 0.19 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|