C21H36Cl3N3O5 — CID 123794943
2,2,2-trichloroethyl 1-[2-[[3-methyl-2-[(2-methylpropan-2-yl)oxymethylamino]butanoyl]amino]propanoyl]piperidine-3-carboxylate (PubChem CID 123794943) has the molecular formula C21H36Cl3N3O5 and a molecular weight of 516.89 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 1-[2-[[3-methyl-2-[(2-methylpropan-2-yl)oxymethylamino]butanoyl]amino]propanoyl]piperidine-3-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 1-[2-[[3-methyl-2-[(2-methylpropan-2-yl)oxymethylamino]butanoyl]amino]propanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 123794943 |
| Molecular Formula | C21H36Cl3N3O5 |
| Molecular Weight | 516.89 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 2,2,2-trichloroethyl 1-[2-[[3-methyl-2-[(2-methylpropan-2-yl)oxymethylamino]butanoyl]amino]propanoyl]piperidine-3-carboxylate |
| SMILES | CC(NC(=O)C(NCOC(C)(C)C)C(C)C)C(=O)N1CCCC(C(=O)OCC(Cl)(Cl)Cl)C1 |
| InChI | InChI=1S/C21H36Cl3N3O5/c1-13(2)16(25-12-32-20(4,5)6)17(28)26-14(3)18(29)27-9-7-8-15(10-27)19(30)31-11-21(22,23)24/h13-16,25H,7-12H2,1-6H3,(H,26,28) |
| InChIKey | ZWWKMBBMXNZDOO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.89 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|