C12H21NO3S — CID 123795075
trans-ethyl (1R,2R)-2-[2-[(R)-tert-butylsulfinyl]iminoethyl]cyclopropane-1-carboxylate (PubChem CID 123795075) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is trans-ethyl (1R,2R)-2-[2-[(R)-tert-butylsulfinyl]iminoethyl]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2R)-2-[2-[(R)-tert-butylsulfinyl]iminoethyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 123795075 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | trans-ethyl (1R,2R)-2-[2-[(R)-tert-butylsulfinyl]iminoethyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]1CC=N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C12H21NO3S/c1-5-16-11(14)10-8-9(10)6-7-13-17(15)12(2,3)4/h7,9-10H,5-6,8H2,1-4H3/t9-,10+,17+/m0/s1 |
| InChIKey | AXAGMSOBSFRYIV-YAXFVEMYSA-N |
| XLogP | 2.11 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|