C21H15F3N4O3S — CID 123795838
N-(4-methylperoxysulfanylphenyl)-3-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyrazine-6-carboxamide (PubChem CID 123795838) has the molecular formula C21H15F3N4O3S and a molecular weight of 460.44 g/mol. Its IUPAC name is N-(4-methylperoxysulfanylphenyl)-3-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyrazine-6-carboxamide.
| Compound Name | N-(4-methylperoxysulfanylphenyl)-3-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 123795838 |
| Molecular Formula | C21H15F3N4O3S |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | N-(4-methylperoxysulfanylphenyl)-3-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyrazine-6-carboxamide |
| SMILES | COOSc1ccc(NC(=O)c2cn3c(-c4ccc(C(F)(F)F)cc4)cnc3cn2)cc1 |
| InChI | InChI=1S/C21H15F3N4O3S/c1-30-31-32-16-8-6-15(7-9-16)27-20(29)17-12-28-18(10-26-19(28)11-25-17)13-2-4-14(5-3-13)21(22,23)24/h2-12H,1H3,(H,27,29) |
| InChIKey | CTGAXNRGAGECRX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|