C21H14ClF3N6O2 — CID 90157600
6-N-(6-chloro-3-pyridinyl)-6-N-methyl-3-N-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyrazine-3,6-dicarboxamide (PubChem CID 90157600) has the molecular formula C21H14ClF3N6O2 and a molecular weight of 474.83 g/mol. Its IUPAC name is 6-N-(6-chloro-3-pyridinyl)-6-N-methyl-3-N-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyrazine-3,6-dicarboxamide.
| Compound Name | 6-N-(6-chloro-3-pyridinyl)-6-N-methyl-3-N-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyrazine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 90157600 |
| Molecular Formula | C21H14ClF3N6O2 |
| Molecular Weight | 474.83 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 6-N-(6-chloro-3-pyridinyl)-6-N-methyl-3-N-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyrazine-3,6-dicarboxamide |
| SMILES | CN(C(=O)c1cn2c(C(=O)Nc3ccc(C(F)(F)F)cc3)cnc2cn1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C21H14ClF3N6O2/c1-30(14-6-7-17(22)27-8-14)20(33)15-11-31-16(9-28-18(31)10-26-15)19(32)29-13-4-2-12(3-5-13)21(23,24)25/h2-11H,1H3,(H,29,32) |
| InChIKey | HQPUJSLOUQELFV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.83 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|