C20H13F3N8O2 — CID 90176020
N-[5-(hydrazinylidenecarbamoyl)-2-pyridinyl]-3-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyrazine-6-carboxamide (PubChem CID 90176020) has the molecular formula C20H13F3N8O2 and a molecular weight of 454.37 g/mol. Its IUPAC name is N-[5-(hydrazinylidenecarbamoyl)-2-pyridinyl]-3-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyrazine-6-carboxamide.
| Compound Name | N-[5-(hydrazinylidenecarbamoyl)-2-pyridinyl]-3-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 90176020 |
| Molecular Formula | C20H13F3N8O2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-[5-(hydrazinylidenecarbamoyl)-2-pyridinyl]-3-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyrazine-6-carboxamide |
| SMILES | N/N=N/C(=O)c1ccc(NC(=O)c2cn3c(-c4ccc(C(F)(F)F)cc4)cnc3cn2)nc1 |
| InChI | InChI=1S/C20H13F3N8O2/c21-20(22,23)13-4-1-11(2-5-13)15-8-27-17-9-25-14(10-31(15)17)19(33)28-16-6-3-12(7-26-16)18(32)29-30-24/h1-10H,(H2,24,29,32)(H,26,28,33) |
| InChIKey | MFNSMFZQLIOEFY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 139.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|