C24H29F3N2O5 — CID 123799238
5-[[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methyl]-2,2-dimethyl-7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridine (PubChem CID 123799238) has the molecular formula C24H29F3N2O5 and a molecular weight of 482.50 g/mol. Its IUPAC name is 5-[[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methyl]-2,2-dimethyl-7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridine.
| Compound Name | 5-[[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methyl]-2,2-dimethyl-7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 123799238 |
| Molecular Formula | C24H29F3N2O5 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 5-[[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methyl]-2,2-dimethyl-7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridine |
| SMILES | COc1cc(CN2CCC3(c4ccccn4)OC(C)(C)OC3C2)ccc1OCCOC(F)(F)F |
| InChI | InChI=1S/C24H29F3N2O5/c1-22(2)33-21-16-29(11-9-23(21,34-22)20-6-4-5-10-28-20)15-17-7-8-18(19(14-17)30-3)31-12-13-32-24(25,26)27/h4-8,10,14,21H,9,11-13,15-16H2,1-3H3 |
| InChIKey | RVCXVWJIUBNYHK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 62.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|