C19H22BBrNO6P — CID 123800360
CID 123800360 (PubChem CID 123800360) has the molecular formula C19H22BBrNO6P and a molecular weight of 482.08 g/mol.
| Compound Name | CID 123800360 |
|---|---|
| PubChem CID | 123800360 |
| Molecular Formula | C19H22BBrNO6P |
| Molecular Weight | 482.08 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | — |
| SMILES | [B]c1cc(CP(C)(=O)O)cc(Br)c1Oc1ccc(O)c(C(=O)NCCOCC)c1 |
| InChI | InChI=1S/C19H22BBrNO6P/c1-3-27-7-6-22-19(24)14-10-13(4-5-17(14)23)28-18-15(20)8-12(9-16(18)21)11-29(2,25)26/h4-5,8-10,23H,3,6-7,11H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | UPLYGVISNBHEAB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.08 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|