C23H36N2O7 — CID 20676599
tert-butyl 2-[[3-(2-ethoxyethylcarbamoyl)-4-hydroxyphenyl]methoxycarbonylamino]-4-methylpentanoate (PubChem CID 20676599) has the molecular formula C23H36N2O7 and a molecular weight of 452.55 g/mol. Its IUPAC name is tert-butyl 2-[[3-(2-ethoxyethylcarbamoyl)-4-hydroxyphenyl]methoxycarbonylamino]-4-methylpentanoate.
| Compound Name | tert-butyl 2-[[3-(2-ethoxyethylcarbamoyl)-4-hydroxyphenyl]methoxycarbonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 20676599 |
| Molecular Formula | C23H36N2O7 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | tert-butyl 2-[[3-(2-ethoxyethylcarbamoyl)-4-hydroxyphenyl]methoxycarbonylamino]-4-methylpentanoate |
| SMILES | CCOCCNC(=O)c1cc(COC(=O)NC(CC(C)C)C(=O)OC(C)(C)C)ccc1O |
| InChI | InChI=1S/C23H36N2O7/c1-7-30-11-10-24-20(27)17-13-16(8-9-19(17)26)14-31-22(29)25-18(12-15(2)3)21(28)32-23(4,5)6/h8-9,13,15,18,26H,7,10-12,14H2,1-6H3,(H,24,27)(H,25,29) |
| InChIKey | LVXBNOFKVKIFCA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|