C16H25FO2 — CID 123801205
4-(8-fluoro-6-methyl-5-methylidenenona-1,3-dien-4-yl)oxyoxane (PubChem CID 123801205) has the molecular formula C16H25FO2 and a molecular weight of 268.37 g/mol. Its IUPAC name is 4-(8-fluoro-6-methyl-5-methylidenenona-1,3-dien-4-yl)oxyoxane.
| Compound Name | 4-(8-fluoro-6-methyl-5-methylidenenona-1,3-dien-4-yl)oxyoxane |
|---|---|
| PubChem CID | 123801205 |
| Molecular Formula | C16H25FO2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 4-(8-fluoro-6-methyl-5-methylidenenona-1,3-dien-4-yl)oxyoxane |
| SMILES | C=CC=C(OC1CCOCC1)C(=C)C(C)CC(C)F |
| InChI | InChI=1S/C16H25FO2/c1-5-6-16(14(4)12(2)11-13(3)17)19-15-7-9-18-10-8-15/h5-6,12-13,15H,1,4,7-11H2,2-3H3 |
| InChIKey | RRAFNQUONMPGBH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|