C26H29F5O3 — CID 143772901
5-[difluoro-[(3E,7Z,11Z)-4,11,12-trifluoro-13-methoxy-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaen-2-yl]oxymethyl]-2-methyloxane (PubChem CID 143772901) has the molecular formula C26H29F5O3 and a molecular weight of 484.51 g/mol. Its IUPAC name is 5-[difluoro-[(3E,7Z,11Z)-4,11,12-trifluoro-13-methoxy-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaen-2-yl]oxymethyl]-2-methyloxane.
| Compound Name | 5-[difluoro-[(3E,7Z,11Z)-4,11,12-trifluoro-13-methoxy-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaen-2-yl]oxymethyl]-2-methyloxane |
|---|---|
| PubChem CID | 143772901 |
| Molecular Formula | C26H29F5O3 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 5-[difluoro-[(3E,7Z,11Z)-4,11,12-trifluoro-13-methoxy-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaen-2-yl]oxymethyl]-2-methyloxane |
| SMILES | C=C(/C=C(\F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)OC)OC(F)(F)C1CCC(C)OC1 |
| InChI | InChI=1S/C26H29F5O3/c1-15(9-10-16(2)20(6)24(28)25(29)21(7)32-8)19(5)23(27)13-18(4)34-26(30,31)22-12-11-17(3)33-14-22/h9-10,13,17,22H,1-2,4-7,11-12,14H2,3,8H3/b10-9-,23-13+,25-24- |
| InChIKey | QAOHAFYNWYSDQR-CHPSGTEFSA-N |
| XLogP | 7.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|