C10H13N3O2 — CID 123801734
1-[3-(2-hydroxyethylamino)-4-pyridinyl]-1-iminopropan-2-one (PubChem CID 123801734) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-[3-(2-hydroxyethylamino)-4-pyridinyl]-1-iminopropan-2-one.
| Compound Name | 1-[3-(2-hydroxyethylamino)-4-pyridinyl]-1-iminopropan-2-one |
|---|---|
| PubChem CID | 123801734 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1-[3-(2-hydroxyethylamino)-4-pyridinyl]-1-iminopropan-2-one |
| SMILES | [H]/N=C(\C(C)=O)c1ccncc1NCCO |
| InChI | InChI=1S/C10H13N3O2/c1-7(15)10(11)8-2-3-12-6-9(8)13-4-5-14/h2-3,6,11,13-14H,4-5H2,1H3/b11-10+ |
| InChIKey | RZFGKQQWZXHYKF-ZHACJKMWSA-N |
| XLogP | 0.44 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|