C22H24N6O3 — CID 123847590
6-methyl-N-[1-(methylideneamino)buta-1,3-dienyl]-3-[2-[[4-(2-oxopropanimidoyl)-3-pyridinyl]amino]acetyl]-3-azabicyclo[3.1.0]hex-5-ene-2-carboxamide (PubChem CID 123847590) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 6-methyl-N-[1-(methylideneamino)buta-1,3-dienyl]-3-[2-[[4-(2-oxopropanimidoyl)-3-pyridinyl]amino]acetyl]-3-azabicyclo[3.1.0]hex-5-ene-2-carboxamide.
| Compound Name | 6-methyl-N-[1-(methylideneamino)buta-1,3-dienyl]-3-[2-[[4-(2-oxopropanimidoyl)-3-pyridinyl]amino]acetyl]-3-azabicyclo[3.1.0]hex-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 123847590 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 6-methyl-N-[1-(methylideneamino)buta-1,3-dienyl]-3-[2-[[4-(2-oxopropanimidoyl)-3-pyridinyl]amino]acetyl]-3-azabicyclo[3.1.0]hex-5-ene-2-carboxamide |
| SMILES | [H]/N=C(\C(C)=O)c1ccncc1NCC(=O)N1CC2=C(C)C2C1C(=O)NC(=CC=C)N=C |
| InChI | InChI=1S/C22H24N6O3/c1-5-6-17(24-4)27-22(31)21-19-12(2)15(19)11-28(21)18(30)10-26-16-9-25-8-7-14(16)20(23)13(3)29/h5-9,19,21,23,26H,1,4,10-11H2,2-3H3,(H,27,31)/b17-6?,23-20+ |
| InChIKey | DXXIVKHBVSQDSD-DSYIJDMTSA-N |
| XLogP | 1.45 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|