C28H34N4OS — CID 123801801
N-[[(1S,2S)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclopentyl]methyl]-3-(2-methylphenyl)prop-2-enamide (PubChem CID 123801801) has the molecular formula C28H34N4OS and a molecular weight of 474.67 g/mol. Its IUPAC name is N-[[(1S,2S)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclopentyl]methyl]-3-(2-methylphenyl)prop-2-enamide.
| Compound Name | N-[[(1S,2S)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclopentyl]methyl]-3-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 123801801 |
| Molecular Formula | C28H34N4OS |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | N-[[(1S,2S)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclopentyl]methyl]-3-(2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccccc1C=CC(=O)NC[C@H]1CCC[C@@H]1CN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C28H34N4OS/c1-21-7-2-3-8-22(21)13-14-27(33)29-19-23-9-6-10-24(23)20-31-15-17-32(18-16-31)28-25-11-4-5-12-26(25)34-30-28/h2-5,7-8,11-14,23-24H,6,9-10,15-20H2,1H3,(H,29,33)/t23-,24-/m1/s1 |
| InChIKey | HURMGEJPHSJJOU-DNQXCXABSA-N |
| XLogP | 4.97 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|