C28H31N5O5S — CID 58098174
(E)-N-[[(1S,2S)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclopentyl]methyl]-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide (PubChem CID 58098174) has the molecular formula C28H31N5O5S and a molecular weight of 549.65 g/mol. Its IUPAC name is (E)-N-[[(1S,2S)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclopentyl]methyl]-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[[(1S,2S)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclopentyl]methyl]-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 58098174 |
| Molecular Formula | C28H31N5O5S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | (E)-N-[[(1S,2S)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclopentyl]methyl]-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2)NC[C@H]1CCC[C@@H]1CN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C28H31N5O5S/c34-27(9-8-19-14-24-25(38-18-37-24)15-23(19)33(35)36)29-16-20-4-3-5-21(20)17-31-10-12-32(13-11-31)28-22-6-1-2-7-26(22)39-30-28/h1-2,6-9,14-15,20-21H,3-5,10-13,16-18H2,(H,29,34)/b9-8+/t20-,21-/m1/s1 |
| InChIKey | UOPMVPFIEPXXGY-OBDVNYBASA-N |
| XLogP | 4.30 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|