C29H32FN5O5S — CID 58097931
(E)-N-[[(1R,2R)-2-[[4-(6-fluoro-1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide (PubChem CID 58097931) has the molecular formula C29H32FN5O5S and a molecular weight of 581.67 g/mol. Its IUPAC name is (E)-N-[[(1R,2R)-2-[[4-(6-fluoro-1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[[(1R,2R)-2-[[4-(6-fluoro-1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 58097931 |
| Molecular Formula | C29H32FN5O5S |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | (E)-N-[[(1R,2R)-2-[[4-(6-fluoro-1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2)NC[C@@H]1CCCC[C@H]1CN1CCN(c2nsc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C29H32FN5O5S/c30-22-6-7-23-27(14-22)41-32-29(23)34-11-9-33(10-12-34)17-21-4-2-1-3-20(21)16-31-28(36)8-5-19-13-25-26(40-18-39-25)15-24(19)35(37)38/h5-8,13-15,20-21H,1-4,9-12,16-18H2,(H,31,36)/b8-5+/t20-,21-/m0/s1 |
| InChIKey | CLDOJIBMJATCPF-UOBDRKKNSA-N |
| XLogP | 4.83 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|