C25H27ClN4OS — CID 58098130
(E)-N-[[2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclopropyl]methyl]-3-(3-chlorophenyl)prop-2-enamide (PubChem CID 58098130) has the molecular formula C25H27ClN4OS and a molecular weight of 467.04 g/mol. Its IUPAC name is (E)-N-[[2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclopropyl]methyl]-3-(3-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclopropyl]methyl]-3-(3-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 58098130 |
| Molecular Formula | C25H27ClN4OS |
| Molecular Weight | 467.04 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (E)-N-[[2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclopropyl]methyl]-3-(3-chlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)NCC1CC1CN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C25H27ClN4OS/c26-21-5-3-4-18(14-21)8-9-24(31)27-16-19-15-20(19)17-29-10-12-30(13-11-29)25-22-6-1-2-7-23(22)32-28-25/h1-9,14,19-20H,10-13,15-17H2,(H,27,31)/b9-8+ |
| InChIKey | YHKAQOWTAVQSPV-CMDGGOBGSA-N |
| XLogP | 4.54 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.04 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|