About spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane]
spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane] (PubChem CID 123804812) has the molecular formula C7H10
and a molecular weight of 94.16 g/mol. Its IUPAC name is spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane].
Analyze spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane]?
The IUPAC name of spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane] (CID 123804812) is spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane].
What is the SMILES notation for spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane]?
The canonical SMILES for spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane] is C1C2CC1C21CC1.
What is the InChIKey of spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane]?
The InChIKey is KCSFZPGQAROMBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10/c1-2-7(1)5-3-6(7)4-5/h5-6H,1-4H2.
What are the key properties of spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane]?
spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane] has a molecular weight of 94.16 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[bicyclo[1.1.1]pentane-2,1'-cyclopropane] is sourced from PubChem (CID 123804812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).