C15H27NO5 — CID 123806643
7-(2-aminoethyl)-8-(2-hydroxypropan-2-yloxy)-2,2-dimethyl-1,3-dioxaspiro[4.5]decan-4-one (PubChem CID 123806643) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is 7-(2-aminoethyl)-8-(2-hydroxypropan-2-yloxy)-2,2-dimethyl-1,3-dioxaspiro[4.5]decan-4-one.
| Compound Name | 7-(2-aminoethyl)-8-(2-hydroxypropan-2-yloxy)-2,2-dimethyl-1,3-dioxaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 123806643 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 7-(2-aminoethyl)-8-(2-hydroxypropan-2-yloxy)-2,2-dimethyl-1,3-dioxaspiro[4.5]decan-4-one |
| SMILES | CC(C)(O)OC1CCC2(CC1CCN)OC(C)(C)OC2=O |
| InChI | InChI=1S/C15H27NO5/c1-13(2,18)19-11-5-7-15(9-10(11)6-8-16)12(17)20-14(3,4)21-15/h10-11,18H,5-9,16H2,1-4H3 |
| InChIKey | WXVKRTULJPPSBX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|