C11H21NO5 — CID 163760863
(4S,5R,6S)-5-aminooxy-6-ethyl-4-(2-hydroxypropan-2-yloxy)-6-methyloxan-2-one (PubChem CID 163760863) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is (4S,5R,6S)-5-aminooxy-6-ethyl-4-(2-hydroxypropan-2-yloxy)-6-methyloxan-2-one.
| Compound Name | (4S,5R,6S)-5-aminooxy-6-ethyl-4-(2-hydroxypropan-2-yloxy)-6-methyloxan-2-one |
|---|---|
| PubChem CID | 163760863 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (4S,5R,6S)-5-aminooxy-6-ethyl-4-(2-hydroxypropan-2-yloxy)-6-methyloxan-2-one |
| SMILES | CC[C@]1(C)OC(=O)C[C@H](OC(C)(C)O)[C@H]1ON |
| InChI | InChI=1S/C11H21NO5/c1-5-11(4)9(17-12)7(6-8(13)16-11)15-10(2,3)14/h7,9,14H,5-6,12H2,1-4H3/t7-,9+,11-/m0/s1 |
| InChIKey | LYAYHNSUDDBTIP-NMLBEHRDSA-N |
| XLogP | 0.47 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|