C9H14O5 — CID 138664734
3-(2-hydroxypropan-2-yloxy)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 138664734) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-(2-hydroxypropan-2-yloxy)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | 3-(2-hydroxypropan-2-yloxy)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 138664734 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 3-(2-hydroxypropan-2-yloxy)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | CC(C)(O)OC1COC2CC(=O)OC21 |
| InChI | InChI=1S/C9H14O5/c1-9(2,11)14-6-4-12-5-3-7(10)13-8(5)6/h5-6,8,11H,3-4H2,1-2H3 |
| InChIKey | IEWJBQRKIAZAPU-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|