C9H16O4 — CID 147454887
2-[(2R)-5-[(2R)-oxiran-2-yl]oxolan-2-yl]oxypropan-2-ol (PubChem CID 147454887) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 2-[(2R)-5-[(2R)-oxiran-2-yl]oxolan-2-yl]oxypropan-2-ol.
| Compound Name | 2-[(2R)-5-[(2R)-oxiran-2-yl]oxolan-2-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 147454887 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 2-[(2R)-5-[(2R)-oxiran-2-yl]oxolan-2-yl]oxypropan-2-ol |
| SMILES | CC(C)(O)O[C@@H]1CCC([C@H]2CO2)O1 |
| InChI | InChI=1S/C9H16O4/c1-9(2,10)13-8-4-3-6(12-8)7-5-11-7/h6-8,10H,3-5H2,1-2H3/t6?,7-,8-/m1/s1 |
| InChIKey | DYTXNOOHZXXLHB-SPDVFEMOSA-N |
| XLogP | 0.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|