C26H44O7 — CID 101133158
2-[(2R,5S)-5-[(2R,5S)-5-[(2R,5R)-5-[(2S,5R)-5-[(2S,5R)-5-(2-hydroxypropan-2-yl)oxolan-2-yl]oxolan-2-yl]oxolan-2-yl]oxolan-2-yl]oxolan-2-yl]propan-2-ol (PubChem CID 101133158) has the molecular formula C26H44O7 and a molecular weight of 468.63 g/mol. Its IUPAC name is 2-[(2R,5S)-5-[(2R,5S)-5-[(2R,5R)-5-[(2S,5R)-5-[(2S,5R)-5-(2-hydroxypropan-2-yl)oxolan-2-yl]oxolan-2-yl]oxolan-2-yl]oxolan-2-yl]oxolan-2-yl]propan-2-ol.
| Compound Name | 2-[(2R,5S)-5-[(2R,5S)-5-[(2R,5R)-5-[(2S,5R)-5-[(2S,5R)-5-(2-hydroxypropan-2-yl)oxolan-2-yl]oxolan-2-yl]oxolan-2-yl]oxolan-2-yl]oxolan-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 101133158 |
| Molecular Formula | C26H44O7 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | 2-[(2R,5S)-5-[(2R,5S)-5-[(2R,5R)-5-[(2S,5R)-5-[(2S,5R)-5-(2-hydroxypropan-2-yl)oxolan-2-yl]oxolan-2-yl]oxolan-2-yl]oxolan-2-yl]oxolan-2-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@H]1CC[C@@H]([C@H]2CC[C@@H]([C@H]3CC[C@H]([C@@H]4CC[C@H]([C@@H]5CC[C@H](C(C)(C)O)O5)O4)O3)O2)O1 |
| InChI | InChI=1S/C26H44O7/c1-25(2,27)23-13-11-21(32-23)19-9-7-17(30-19)15-5-6-16(29-15)18-8-10-20(31-18)22-12-14-24(33-22)26(3,4)28/h15-24,27-28H,5-14H2,1-4H3/t15-,16-,17+,18+,19-,20-,21+,22+,23-,24-/m1/s1 |
| InChIKey | RBBXECYNTJPNFM-WGBXWVCZSA-N |
| XLogP | 3.27 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |