C23H26FN5O3S — CID 123806771
N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-1H-pyrrolo[2,3-b]pyridine-4-sulfonamide (PubChem CID 123806771) has the molecular formula C23H26FN5O3S and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-1H-pyrrolo[2,3-b]pyridine-4-sulfonamide.
| Compound Name | N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-1H-pyrrolo[2,3-b]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 123806771 |
| Molecular Formula | C23H26FN5O3S |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-1H-pyrrolo[2,3-b]pyridine-4-sulfonamide |
| SMILES | O=S(=O)(NCCCCN1CCC(c2noc3cc(F)ccc23)CC1)c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C23H26FN5O3S/c24-17-3-4-18-20(15-17)32-28-22(18)16-7-13-29(14-8-16)12-2-1-9-27-33(30,31)21-6-11-26-23-19(21)5-10-25-23/h3-6,10-11,15-16,27H,1-2,7-9,12-14H2,(H,25,26) |
| InChIKey | BYOJXPJTUQJDTF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|