C28H56OSi — CID 123806799
4,4,7,9,9,12-hexamethyltrideca-6,11-dienoxy-tri(propan-2-yl)silane (PubChem CID 123806799) has the molecular formula C28H56OSi and a molecular weight of 436.84 g/mol. Its IUPAC name is 4,4,7,9,9,12-hexamethyltrideca-6,11-dienoxy-tri(propan-2-yl)silane.
| Compound Name | 4,4,7,9,9,12-hexamethyltrideca-6,11-dienoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 123806799 |
| Molecular Formula | C28H56OSi |
| Molecular Weight | 436.84 g/mol |
| Exact Mass | 436.41 |
| IUPAC Name | 4,4,7,9,9,12-hexamethyltrideca-6,11-dienoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)=CCC(C)(C)CC(C)=CCC(C)(C)CCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H56OSi/c1-22(2)15-18-28(12,13)21-26(9)16-19-27(10,11)17-14-20-29-30(23(3)4,24(5)6)25(7)8/h15-16,23-25H,14,17-21H2,1-13H3 |
| InChIKey | JTWPWXSZHWYAAS-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.84 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|