C5H6FNO2 — CID 123807595
4-fluoro-3-methyl-5-methylidene-1,3-oxazolidin-2-one (PubChem CID 123807595) has the molecular formula C5H6FNO2 and a molecular weight of 131.11 g/mol. Its IUPAC name is 4-fluoro-3-methyl-5-methylidene-1,3-oxazolidin-2-one.
| Compound Name | 4-fluoro-3-methyl-5-methylidene-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123807595 |
| Molecular Formula | C5H6FNO2 |
| Molecular Weight | 131.11 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | 4-fluoro-3-methyl-5-methylidene-1,3-oxazolidin-2-one |
| SMILES | C=C1OC(=O)N(C)C1F |
| InChI | InChI=1S/C5H6FNO2/c1-3-4(6)7(2)5(8)9-3/h4H,1H2,2H3 |
| InChIKey | BRPLLRQXYRIMDD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.11 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|