About (5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one
(5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one (PubChem CID 139241459) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is (5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one.
Analyze (5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one?
The IUPAC name of (5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one (CID 139241459) is (5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one?
The canonical SMILES for (5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one is C/C=C1\CN(C)C(=O)O1.
What is the InChIKey of (5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one?
The InChIKey is PPOUMTUVFOLERA-HWKANZROSA-N. The full InChI is InChI=1S/C6H9NO2/c1-3-5-4-7(2)6(8)9-5/h3H,4H2,1-2H3/b5-3+.
What are the key properties of (5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one?
(5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one has a molecular weight of 127.14 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-ethylidene-3-methyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 139241459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).