C31H27N3O4 — CID 123807601
2-[5-(11-ethoxy-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-10-yl)-7-methyl-2-oxo-1-(pyridin-4-ylmethyl)quinolin-6-yl]acetaldehyde (PubChem CID 123807601) has the molecular formula C31H27N3O4 and a molecular weight of 505.57 g/mol. Its IUPAC name is 2-[5-(11-ethoxy-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-10-yl)-7-methyl-2-oxo-1-(pyridin-4-ylmethyl)quinolin-6-yl]acetaldehyde.
| Compound Name | 2-[5-(11-ethoxy-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-10-yl)-7-methyl-2-oxo-1-(pyridin-4-ylmethyl)quinolin-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 123807601 |
| Molecular Formula | C31H27N3O4 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 2-[5-(11-ethoxy-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-10-yl)-7-methyl-2-oxo-1-(pyridin-4-ylmethyl)quinolin-6-yl]acetaldehyde |
| SMILES | CCOc1cc2c3c(ccnc3c1-c1c(CC=O)c(C)cc3c1ccc(=O)n3Cc1ccncc1)CCO2 |
| InChI | InChI=1S/C31H27N3O4/c1-3-37-26-17-25-28-21(10-15-38-25)8-13-33-31(28)30(26)29-22(9-14-35)19(2)16-24-23(29)4-5-27(36)34(24)18-20-6-11-32-12-7-20/h4-8,11-14,16-17H,3,9-10,15,18H2,1-2H3 |
| InChIKey | UMKGKZWSARGLIU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|