C14H13ClN8 — CID 123807903
12-chloro-11-isocyano-7-(4-methylpiperazin-1-yl)-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene (PubChem CID 123807903) has the molecular formula C14H13ClN8 and a molecular weight of 328.77 g/mol. Its IUPAC name is 12-chloro-11-isocyano-7-(4-methylpiperazin-1-yl)-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene.
| Compound Name | 12-chloro-11-isocyano-7-(4-methylpiperazin-1-yl)-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 123807903 |
| Molecular Formula | C14H13ClN8 |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 12-chloro-11-isocyano-7-(4-methylpiperazin-1-yl)-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
| SMILES | [C-]#[N+]c1nc2nc(N3CCN(C)CC3)c3nncn3c2cc1Cl |
| InChI | InChI=1S/C14H13ClN8/c1-16-11-9(15)7-10-12(18-11)19-13(14-20-17-8-23(10)14)22-5-3-21(2)4-6-22/h7-8H,3-6H2,2H3 |
| InChIKey | GXQUMWUCJOISBD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|