C13H14ClN7 — CID 89477685
(3R)-1-(12-chloro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)-N-methylpyrrolidin-3-amine (PubChem CID 89477685) has the molecular formula C13H14ClN7 and a molecular weight of 303.76 g/mol. Its IUPAC name is (3R)-1-(12-chloro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)-N-methylpyrrolidin-3-amine.
| Compound Name | (3R)-1-(12-chloro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)-N-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 89477685 |
| Molecular Formula | C13H14ClN7 |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (3R)-1-(12-chloro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)-N-methylpyrrolidin-3-amine |
| SMILES | CN[C@@H]1CCN(c2nc3ncc(Cl)cc3n3cnnc23)C1 |
| InChI | InChI=1S/C13H14ClN7/c1-15-9-2-3-20(6-9)12-13-19-17-7-21(13)10-4-8(14)5-16-11(10)18-12/h4-5,7,9,15H,2-3,6H2,1H3/t9-/m1/s1 |
| InChIKey | AALXPCRBVDDIHT-SECBINFHSA-N |
| XLogP | 1.12 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |