C16H18ClN7O2 — CID 131741444
tert-butyl N-[1-(12-chloro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-yl]carbamate (PubChem CID 131741444) has the molecular formula C16H18ClN7O2 and a molecular weight of 375.82 g/mol. Its IUPAC name is tert-butyl N-[1-(12-chloro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(12-chloro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 131741444 |
| Molecular Formula | C16H18ClN7O2 |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | tert-butyl N-[1-(12-chloro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(c2nc3ncc(Cl)cc3n3cnnc23)C1 |
| InChI | InChI=1S/C16H18ClN7O2/c1-16(2,3)26-15(25)20-10-6-23(7-10)13-14-22-19-8-24(14)11-4-9(17)5-18-12(11)21-13/h4-5,8,10H,6-7H2,1-3H3,(H,20,25) |
| InChIKey | SQOKMPPUFBOWNK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |