C15H20ClN7O2 — CID 131741443
tert-butyl N-[1-(7-chloro-2-hydrazinylpyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]carbamate (PubChem CID 131741443) has the molecular formula C15H20ClN7O2 and a molecular weight of 365.83 g/mol. Its IUPAC name is tert-butyl N-[1-(7-chloro-2-hydrazinylpyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(7-chloro-2-hydrazinylpyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 131741443 |
| Molecular Formula | C15H20ClN7O2 |
| Molecular Weight | 365.83 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | tert-butyl N-[1-(7-chloro-2-hydrazinylpyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(c2nc3ncc(Cl)cc3nc2NN)C1 |
| InChI | InChI=1S/C15H20ClN7O2/c1-15(2,3)25-14(24)19-9-6-23(7-9)13-12(22-17)20-10-4-8(16)5-18-11(10)21-13/h4-5,9H,6-7,17H2,1-3H3,(H,19,24)(H,20,22) |
| InChIKey | KYNQARQLYSHBOB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.83 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|