About tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate
tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate (PubChem CID 131741448) has the molecular formula C16H19Cl2N5O2
and a molecular weight of 384.27 g/mol. Its IUPAC name is tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate |
| PubChem CID | 131741448 |
| Molecular Formula | C16H19Cl2N5O2 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CN(c2nc3ncc(Cl)cc3nc2Cl)C1 |
| InChI | InChI=1S/C16H19Cl2N5O2/c1-16(2,3)25-15(24)22(4)10-7-23(8-10)14-12(18)20-11-5-9(17)6-19-13(11)21-14/h5-6,10H,7-8H2,1-4H3 |
| InChIKey | VPCQXELZSOLEPZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate (CID 131741448) is tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate is CN(C(=O)OC(C)(C)C)C1CN(c2nc3ncc(Cl)cc3nc2Cl)C1.
What is the InChIKey of tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate?
The InChIKey is VPCQXELZSOLEPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19Cl2N5O2/c1-16(2,3)25-15(24)22(4)10-7-23(8-10)14-12(18)20-11-5-9(17)6-19-13(11)21-14/h5-6,10H,7-8H2,1-4H3.
What are the key properties of tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate?
tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate has a molecular weight of 384.27 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl]-N-methylcarbamate is sourced from PubChem (CID 131741448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).