C16H19ClN6O4 — CID 142769671
[1-(2-chloro-7-nitropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl] N-tert-butyl-N-methylcarbamate (PubChem CID 142769671) has the molecular formula C16H19ClN6O4 and a molecular weight of 394.82 g/mol. Its IUPAC name is [1-(2-chloro-7-nitropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl] N-tert-butyl-N-methylcarbamate.
| Compound Name | [1-(2-chloro-7-nitropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl] N-tert-butyl-N-methylcarbamate |
|---|---|
| PubChem CID | 142769671 |
| Molecular Formula | C16H19ClN6O4 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [1-(2-chloro-7-nitropyrido[2,3-b]pyrazin-3-yl)azetidin-3-yl] N-tert-butyl-N-methylcarbamate |
| SMILES | CN(C(=O)OC1CN(c2nc3ncc([N+](=O)[O-])cc3nc2Cl)C1)C(C)(C)C |
| InChI | InChI=1S/C16H19ClN6O4/c1-16(2,3)21(4)15(24)27-10-7-22(8-10)14-12(17)19-11-5-9(23(25)26)6-18-13(11)20-14/h5-6,10H,7-8H2,1-4H3 |
| InChIKey | GAJSTXHFDOGYRG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 114.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|