C16H19ClN8O2 — CID 142769693
[1-(12-chloro-2,3,4,5,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-yl] N-tert-butyl-N-methylcarbamate (PubChem CID 142769693) has the molecular formula C16H19ClN8O2 and a molecular weight of 390.84 g/mol. Its IUPAC name is [1-(12-chloro-2,3,4,5,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-yl] N-tert-butyl-N-methylcarbamate.
| Compound Name | [1-(12-chloro-2,3,4,5,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-yl] N-tert-butyl-N-methylcarbamate |
|---|---|
| PubChem CID | 142769693 |
| Molecular Formula | C16H19ClN8O2 |
| Molecular Weight | 390.84 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [1-(12-chloro-2,3,4,5,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-yl] N-tert-butyl-N-methylcarbamate |
| SMILES | CN(C(=O)OC1CN(c2nc3ncc(Cl)cc3n3nnnc23)C1)C(C)(C)C |
| InChI | InChI=1S/C16H19ClN8O2/c1-16(2,3)23(4)15(26)27-10-7-24(8-10)13-14-20-21-22-25(14)11-5-9(17)6-18-12(11)19-13/h5-6,10H,7-8H2,1-4H3 |
| InChIKey | FYWOPRKLSHNFSE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 101.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.84 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |