C17H22Cl2N5O2+ — CID 123852506
tert-butyl N-[1-(2,7-dichloro-1-methylpyrido[3,2-d]pyrimidin-1-ium-4-yl)azetidin-3-yl]-N-methylcarbamate (PubChem CID 123852506) has the molecular formula C17H22Cl2N5O2+ and a molecular weight of 399.30 g/mol. Its IUPAC name is tert-butyl N-[1-(2,7-dichloro-1-methylpyrido[3,2-d]pyrimidin-1-ium-4-yl)azetidin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(2,7-dichloro-1-methylpyrido[3,2-d]pyrimidin-1-ium-4-yl)azetidin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123852506 |
| Molecular Formula | C17H22Cl2N5O2+ |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | tert-butyl N-[1-(2,7-dichloro-1-methylpyrido[3,2-d]pyrimidin-1-ium-4-yl)azetidin-3-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CN(c2nc(Cl)[n+](C)c3cc(Cl)cnc23)C1 |
| InChI | InChI=1S/C17H22Cl2N5O2/c1-17(2,3)26-16(25)22(4)11-8-24(9-11)14-13-12(6-10(18)7-20-13)23(5)15(19)21-14/h6-7,11H,8-9H2,1-5H3/q+1 |
| InChIKey | CNPKBSYPTKPQDL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|