C24H21F4N3O4S — CID 123810355
2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[[2-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]methyl]but-2-enamide (PubChem CID 123810355) has the molecular formula C24H21F4N3O4S and a molecular weight of 523.51 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[[2-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]methyl]but-2-enamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[[2-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 123810355 |
| Molecular Formula | C24H21F4N3O4S |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[[2-[4-(trifluoromethoxy)phenyl]-4-pyridinyl]methyl]but-2-enamide |
| SMILES | CC=C(C(=O)NCc1ccnc(-c2ccc(OC(F)(F)F)cc2)c1)N(C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H21F4N3O4S/c1-3-22(31(2)36(33,34)20-10-6-18(25)7-11-20)23(32)30-15-16-12-13-29-21(14-16)17-4-8-19(9-5-17)35-24(26,27)28/h3-14H,15H2,1-2H3,(H,30,32) |
| InChIKey | YUGYREYVVWICEK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|