C20H28N4O2 — CID 123812142
2-(1-cyclohexylpiperidin-2-yl)-1-methyl-3-oxoindazole-4-carboxamide (PubChem CID 123812142) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-(1-cyclohexylpiperidin-2-yl)-1-methyl-3-oxoindazole-4-carboxamide.
| Compound Name | 2-(1-cyclohexylpiperidin-2-yl)-1-methyl-3-oxoindazole-4-carboxamide |
|---|---|
| PubChem CID | 123812142 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-(1-cyclohexylpiperidin-2-yl)-1-methyl-3-oxoindazole-4-carboxamide |
| SMILES | Cn1c2cccc(C(N)=O)c2c(=O)n1C1CCCCN1C1CCCCC1 |
| InChI | InChI=1S/C20H28N4O2/c1-22-16-11-7-10-15(19(21)25)18(16)20(26)24(22)17-12-5-6-13-23(17)14-8-3-2-4-9-14/h7,10-11,14,17H,2-6,8-9,12-13H2,1H3,(H2,21,25) |
| InChIKey | NUOHWWZZBOOZPK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |