C15H23NO5 — CID 123812432
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(6-oxabicyclo[3.1.0]hex-3-en-1-yl)carbamate (PubChem CID 123812432) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(6-oxabicyclo[3.1.0]hex-3-en-1-yl)carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(6-oxabicyclo[3.1.0]hex-3-en-1-yl)carbamate |
|---|---|
| PubChem CID | 123812432 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(6-oxabicyclo[3.1.0]hex-3-en-1-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C12CC=CC1O2 |
| InChI | InChI=1S/C15H23NO5/c1-13(2,3)20-11(17)16(12(18)21-14(4,5)6)15-9-7-8-10(15)19-15/h7-8,10H,9H2,1-6H3 |
| InChIKey | QZXNDYGVGKHEGN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|