About tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate
tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 154265911) has the molecular formula C15H27NO6
and a molecular weight of 317.38 g/mol. Its IUPAC name is tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| PubChem CID | 154265911 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1(O)CCCC1O |
| InChI | InChI=1S/C15H27NO6/c1-13(2,3)21-11(18)16(12(19)22-14(4,5)6)15(20)9-7-8-10(15)17/h10,17,20H,7-9H2,1-6H3 |
| InChIKey | RDEUCLOZNIFVAO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate?
The IUPAC name of tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CID 154265911) is tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
What is the SMILES notation for tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate?
The canonical SMILES for tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate is CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1(O)CCCC1O.
What is the InChIKey of tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate?
The InChIKey is RDEUCLOZNIFVAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO6/c1-13(2,3)21-11(18)16(12(19)22-14(4,5)6)15(20)9-7-8-10(15)17/h10,17,20H,7-9H2,1-6H3.
What are the key properties of tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate?
tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate has a molecular weight of 317.38 g/mol, XLogP of 2.39, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(1,2-dihydroxycyclopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate is sourced from PubChem (CID 154265911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).