C16H21F3 — CID 123812969
1-butyl-4-[(1-methylcyclopropyl)methyl]-2-(trifluoromethyl)benzene (PubChem CID 123812969) has the molecular formula C16H21F3 and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-butyl-4-[(1-methylcyclopropyl)methyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1-butyl-4-[(1-methylcyclopropyl)methyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 123812969 |
| Molecular Formula | C16H21F3 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-butyl-4-[(1-methylcyclopropyl)methyl]-2-(trifluoromethyl)benzene |
| SMILES | CCCCc1ccc(CC2(C)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H21F3/c1-3-4-5-13-7-6-12(11-15(2)8-9-15)10-14(13)16(17,18)19/h6-7,10H,3-5,8-9,11H2,1-2H3 |
| InChIKey | PPTDJGKGVQKEBC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |