C9H14N2 — CID 123815893
N-[(1E)-3-(ethylideneamino)-2-methylbuta-1,3-dienyl]ethanimine (PubChem CID 123815893) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is N-[(1E)-3-(ethylideneamino)-2-methylbuta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1E)-3-(ethylideneamino)-2-methylbuta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 123815893 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N-[(1E)-3-(ethylideneamino)-2-methylbuta-1,3-dienyl]ethanimine |
| SMILES | C=C(/N=C/C)/C(C)=C/N=C/C |
| InChI | InChI=1S/C9H14N2/c1-5-10-7-8(3)9(4)11-6-2/h5-7H,4H2,1-3H3/b8-7+,10-5+,11-6+ |
| InChIKey | PJNXTETYIVHLKD-WGVLWLRPSA-N |
| XLogP | 2.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|