C13H20O3 — CID 123816566
6-formyl-2-methylundeca-2,4-dienoic acid (PubChem CID 123816566) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 6-formyl-2-methylundeca-2,4-dienoic acid.
| Compound Name | 6-formyl-2-methylundeca-2,4-dienoic acid |
|---|---|
| PubChem CID | 123816566 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 6-formyl-2-methylundeca-2,4-dienoic acid |
| SMILES | CCCCCC(C=O)C=CC=C(C)C(=O)O |
| InChI | InChI=1S/C13H20O3/c1-3-4-5-8-12(10-14)9-6-7-11(2)13(15)16/h6-7,9-10,12H,3-5,8H2,1-2H3,(H,15,16) |
| InChIKey | PLWSJDPAXWSVJG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|