C15H28O7 — CID 123818057
2-[(2S,3R,5R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methyloxan-2-yl]oxyethyl 2,2-dimethylbutanoate (PubChem CID 123818057) has the molecular formula C15H28O7 and a molecular weight of 320.38 g/mol. Its IUPAC name is 2-[(2S,3R,5R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methyloxan-2-yl]oxyethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[(2S,3R,5R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methyloxan-2-yl]oxyethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 123818057 |
| Molecular Formula | C15H28O7 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-[(2S,3R,5R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methyloxan-2-yl]oxyethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCO[C@H]1OC(CO)[C@H](C)C(O)[C@H]1O |
| InChI | InChI=1S/C15H28O7/c1-5-15(3,4)14(19)21-7-6-20-13-12(18)11(17)9(2)10(8-16)22-13/h9-13,16-18H,5-8H2,1-4H3/t9-,10?,11?,12+,13-/m0/s1 |
| InChIKey | IXNCVLNWCSCSHA-NVNOCSQKSA-N |
| XLogP | 0.06 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|