C21H22N3O5+ — CID 123818396
4-[2-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(ethylcarbamoyl)-1-aza-3-azoniacyclobuta-2,3-dien-1-yl]benzoic acid (PubChem CID 123818396) has the molecular formula C21H22N3O5+ and a molecular weight of 396.42 g/mol. Its IUPAC name is 4-[2-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(ethylcarbamoyl)-1-aza-3-azoniacyclobuta-2,3-dien-1-yl]benzoic acid.
| Compound Name | 4-[2-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(ethylcarbamoyl)-1-aza-3-azoniacyclobuta-2,3-dien-1-yl]benzoic acid |
|---|---|
| PubChem CID | 123818396 |
| Molecular Formula | C21H22N3O5+ |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-[2-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(ethylcarbamoyl)-1-aza-3-azoniacyclobuta-2,3-dien-1-yl]benzoic acid |
| SMILES | CCNC(=O)C1=[N+]=C(c2cc(C(C)C)c(O)cc2O)N1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H21N3O5/c1-4-22-20(27)19-23-18(15-9-14(11(2)3)16(25)10-17(15)26)24(19)13-7-5-12(6-8-13)21(28)29/h5-11H,4H2,1-3H3,(H3,22,25,26,27,28,29)/p+1 |
| InChIKey | MDEOMMLJUBWKKB-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|